You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb63257 |
---|---|
Category | Tools |
Description | Crystallization Stock Solution. |
CAS Number | 26522-85-0 |
Concentration | 2 M |
Form/Appearance | liquid |
MW | Theoretical MW: 166.04 g/mol |
SMILES | [O-]C(=O)CC(=O)[O-].[Na].[Na] |
Formula | CH2(CO2Na)2 * H2O |
Storage | store at 4 °C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IF, IHC, WB | |
Human | |
Mouse | |
Monoclonal | |
Unconjugated |
Filter by Rating