You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1990878 |
---|---|
Category | Small Molecules |
Description | Schineolignin B |
Purity | 98.00% |
MW | 374.477 |
Biological Activity | Schineolignin B is a useful organic compound for research related to life sciences and the catalog number is orb1990878. |
Formula | C22H30O5 |
SMILES | COc1ccc(CC(C)C(C)Cc2cc(O)c(OC)c(OC)c2)cc1OC |
Storage | -20°C |
Note | For research use only |