| Category | Small molecules |
|---|---|
| Catalog Number | orb321170 |
| Formula | C36H52O11 |
| Purity | ≥98% |
| Chemical Name | Butanedioic acid, mono(3-butyl-8-(9-carboxy-6- hydroxy-3,7-dimethyl-2,4,8-nonatrienyl)-2-(4-carboxy-3-methyl-1,3-butadienyl)-9-methyl-1,7-dioxaspiro(5.5)undec-3-yl) ester |
| CAS Number | 134615-37-5 |
| MW | 660.79 |
| Note | For research use only. |
| SMILES | CCCCC1(CCC2(CCC(C(O2)CC=C(C)C=CC(C(C)C=CC(=O)O)O)C)OC1C=CC(=CC(=O)O)C)OC(=O)CCC(=O)O |
| Solubility (25°C) | Soluble in DMF, DMSO, ethanol, ethyl acetate or methanol. |
| Storage | -20°C |
| Expiration Date | 12 months from date of receipt. |
| Description | Reveromycin A |
Chemical structure of Reveromycin A
