You have no items in your shopping cart.
Cart summary
Pipazethate hydrochloride
Catalog Number: orb2646222
| Catalog Number | orb2646222 |
|---|---|
| Category | Small Molecules |
| Description | Pipazethate hydrochloride (SKF 70230A; SQ 15874) is an effective GABA antagonist with antitussive properties, making it suitable for research in cough remedies. |
| CAS Number | 6056-11-7 |
| Purity | 98.00% |
| MW | 435.97 |
| SMILES | Cl.O=C(OCCOCCN1CCCCC1)N2C3=NC=CC=C3SC=4C=CC=CC42 |
| Formula | C21H26ClN3O3S |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
