You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb363943 |
---|---|
Category | Small Molecules |
Description | Oxytocin (α-Hypophamine) acetate is a mammalian neurohypophysial hormone; its actions are mediated by specific, high-affinity oxytocin receptors; ligand of oxytocin receptor. |
CAS Number | [6233-83-6] |
MW | 1067.245 |
SMILES | CC(O)=O.O=C([C@H](CSSC[C@@H](C(N[C@H](C1=O)CC2=CC=C(O)C=C2)=O)N)NC([C@@H](NC([C@@H](NC(C(N1)[C@@H](C)CC)=O)CCC(N)=O)=O)CC(N)=O)=O)N(CCC3)[C@@H]3C(N[C@@H](CC(C)C)C(NCC(N)=O)=O)=O |
Formula | C45H70N12O14S2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IF, IHC-Fr, IHC-P | |
Bovine, Equine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ELISA, FC, IHC | |
Human | |
Goat | |
Polyclonal | |
Unconjugated |
Greater than 90% as determined by SDS-PAGE. | |
29.6 kDa | |
E.coli |