You have no items in your shopping cart.
Cart summary
Lenalidomide-PEG3-iodine
Catalog Number: orb1988265
| Catalog Number | orb1988265 |
|---|---|
| Category | Small Molecules |
| Description | Lenalidomide-PEG3-iodine, an E3 ligase ligand-linker conjugate, consists of a cereblon-based Lenalidomide ligand and a 3-unit polyethylene glycol (PEG) linker. This compound is utilized in creating various proteolysis targeting chimeras (PROTACs), including the highly effective PROTAC BTK degrader SJF620, which has a degradation concentration 50 (DC50) of 7.9 nM[1]. |
| Purity | 98.00% |
| MW | 502.3 |
| SMILES | O=C(N1)C(CCC1=O)N(C2=O)CC3=C2C=CC(OCCOCCOCCI)=C3 |
| Formula | C19H23IN2O6 |
| Biological Activity | Lenalidomide-PEG3-iodine, an E3 ligase ligand-linker conjugate, consists of a cereblon-based Lenalidomide ligand and a 3-unit polyethylene glycol (PEG) linker. This compound is utilized in creating various proteolysis targeting chimeras (PROTACs), including the highly effective PROTAC BTK degrader SJF620, which has a degradation concentration 50 (DC50) of 7.9 nM[1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
