You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb746512 |
---|---|
Category | Small Molecules |
Description | UNC6852 is a selective rolycomb repressive complex 2 (PRC2) degrader based on PROTAC and contains an EED (embryonic ectoderm development) ligand and a VHL ligand, with an IC50 of 247 nM for EED. |
MW | 832.969627380371 |
Formula | C43H48N10O6S |
SMILES | O=C(NCCCC(=O)N[C@@H](C(C)(C)C)C(=O)N1C[C@H](O)C[C@H]1C(=O)NCC1C=CC(C2SC=NC=2C)=CC=1)C1C=CC(C2C3=NN=CN3C(NCC3OC=CC=3)=NC=2)=CC=1 |
Note | For research use only |
> 98% (HPLC) | |
2688842-08-0 | |
394.4 | |
C22H22N2O5 |
≥98% | |
2688842-08-0 | |
832.97 | |
C43H48N10O6S |
98.00% | |
629.69 | |
C28H38F3N5O6S |