You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1308745 |
---|---|
Category | Small Molecules |
Description | UNC6852 |
Purity | ≥98% |
MW | 832.97 |
Biological Activity | UNC6852 contains an EED ligand (IC50 = 247 nM) and a von Hippel-Lindau ligand and is a selective polycomb repressive complex 2 (PRC2) degrader based on PROTAC. |
CAS Number | 2688842-08-0 |
Formula | C43H48N10O6S |
SMILES | Cc1ncsc1-c1ccc(CNC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC(=O)CCCNC(=O)c2ccc(cc2)-c2cnc(NCc3ccco3)n3cnnc23)C(C)(C)C)cc1 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
2688842-08-0 | |
394.4 | |
C22H22N2O5 |
98.00% | |
629.69 | |
C28H38F3N5O6S |