You have no items in your shopping cart.
Cart summary
Imiquimod
Catalog Number: orb1310904
| Catalog Number | orb1310904 |
|---|---|
| Category | Small Molecules |
| Description | Imiquimod |
| Purity | 99.66% |
| MW | 240.3 |
| Biological Activity | Imiquimod (R 837) is an immune response modifier that acts as a toll-like receptor 7 agonist. |
| CAS Number | [99011-02-6] |
| Formula | C14H16N4 |
| SMILES | C(C(C)C)N1C=2C=3C(N=C(N)C2N=C1)=CC=CC3 |
| Storage | -20°C |
| Note | For research use only |
