You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1744843 |
---|---|
Category | Small Molecules |
Description | Ethylhydrocupreine (Optochin), a quinine derivative, exhibits antimicrobial properties against S. pneumoniae and antimalarial capabilities targeting Plasmodium falciparum with an IC50 of 25.75 nM. Additionally, it acts as an agonist for Gallus gallus taste 2 receptors (ggTas2r1, ggTas2r2, and ggTas2r7). |
Purity | 98.00% |
MW | 340.46 |
Biological Activity | Ethylhydrocupreine (Optochin), a quinine derivative, exhibits antimicrobial properties against S. pneumoniae and antimalarial capabilities targeting Plasmodium falciparum with an IC50 of 25.75 nM. Additionally, it acts as an agonist for Gallus gallus taste 2 receptors (ggTas2r1, ggTas2r2, and ggTas2r7). |
CAS Number | 522-60-1 |
Formula | C21H28N2O2 |
SMILES | CCOC1=CC=C2N=CC=C(C(O)C3CC4CCN3CC4CC)C2=C1 |
Storage | -20°C |
Note | For research use only |
99.27% | |
3413-58-9 | |
376.92 | |
C21H29ClN2O2 |