You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb105569 |
---|---|
Category | Small Molecules |
Description | Dehydrocorydaline |
CAS Number | [30045-16-0] |
Purity | > 98%,Standard References |
MW | 366.437 |
SMILES | CC1=C(C=CC(OC)=C2OC)C2=C[N+]3=C1C4=CC(OC)=C(OC)C=C4CC3 |
Formula | C22H24NO4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.88% | |
10605-03-5 | |
401.88 | |
C22H24ClNO4 |
99.84% | |
30045-16-0 | |
366.43 | |
C22H24NO4 |
99.79% | |
13005-09-9 | |
428.44 | |
C22H24N2O7 |