You have no items in your shopping cart.
Cart summary
Dehydrocorydaline nitrate
Catalog Number: orb1304637
| Catalog Number | orb1304637 |
|---|---|
| Category | Small Molecules |
| Description | Dehydrocorydaline nitrate |
| CAS Number | 13005-09-9 |
| Purity | 99.79% |
| MW | 428.44 |
| SMILES | [O-][N+]([O-])=O.COc1ccc2c(C)c3-c4cc(OC)c(OC)cc4CC[n+]3cc2c1OC |
| Formula | C22H24N2O7 |
| Biological Activity | 1. Dehydrocorydaline(DHC) not only inhibits antibody-mediated allergic reactions but also influences cell-mediated allergic reactions, and the inhibitory effect of Corydalis Tuber on allergic reactions may be partially attributed to DHC. 2. Dehydrocorydaline can inhibit elevated mitochondrial membrane potential in lipopolysaccharide-stimulated macrophages. 3. Dehydrocorydaline has antinociceptive effects in mouse models of inflammatory pain, the effects involve the opioid receptor and inflammatory cytokines. 4. Dehydrocorydaline has anti-inflammatory activity. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
