You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2279781 |
---|---|
Category | Small Molecules |
Description | Cyclotriazadisulfonamide (CADA) is a specific CD4-targeted HIV entry inhibitors. Cyclotriazadisulfonamide (CADA) inhibits the co-translational translocation of human CD4 (huCD4) into the ER lumen in a signal peptide (SP)-dependent way. |
MW | 581.79 |
CAS Number | [182316-44-5] |
Formula | C31H39N3O4S2 |
SMILES | O=S(N1CC(CN(S(=O)(C2=CC=C(C)C=C2)=O)CCCN(CC3=CC=CC=C3)CCC1)=C)(C4=CC=C(C)C=C4)=O |
Note | For research use only |
98.00% | |
392287-03-5 | |
618.25 | |
C31H40ClN3O4S2 |