You have no items in your shopping cart.
Cart summary
Cnidioside B
Catalog Number: orb2279345
| Catalog Number | orb2279345 |
|---|---|
| Category | Small Molecules |
| Description | Cnidioside B is a natural product that can be used as a reference standard. The CAS number of Cnidioside B is 141896-54-0. |
| CAS Number | 141896-54-0 |
| Purity | 98.00% |
| MW | 398.364 |
| SMILES | COc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(CCC(O)=O)cc2ccoc12 |
| Formula | C18H22O10 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
