You have no items in your shopping cart.
Cart summary
Heronamide C
Catalog Number: orb2299217
| Catalog Number | orb2299217 |
|---|---|
| Category | Small Molecules |
| Description | Heronamide C, a polyketide macrolactam antifungal agent synthesized by marine Actinomycetes, exhibits selective toxicity by inhibiting growth and promoting abnormal cell wall material accumulation in wild-type fission yeast cells (MIC = 0.13-0.28 μM), without affecting Gram-positive bacteria or human cancer cell lines, HeLa and MDA-MB-231. At 20 μM, it triggers reversible morphological alterations, notably the development of large intracellular structures, in HeLa cells. |
| CAS Number | 1257083-94-5 |
| Purity | 98.00% |
| MW | 449.635 |
| SMILES | [H][C@@]1(C\C=C\C=C\CCC)C\C=C\C=C(/C)\C=C\C=C/[C@H](O)[C@H](O)\C=C(/C)\C=C\C=C\C(=O)N1 |
| Formula | C29H39NO3 |
| Biological Activity | Heronamide C, a polyketide macrolactam antifungal agent synthesized by marine Actinomycetes, exhibits selective toxicity by inhibiting growth and promoting abnormal cell wall material accumulation in wild-type fission yeast cells (MIC = 0.13-0.28 μM), without affecting Gram-positive bacteria or human cancer cell lines, HeLa and MDA-MB-231. At 20 μM, it triggers reversible morphological alterations, notably the development of large intracellular structures, in HeLa cells. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
