You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1992512 |
---|---|
Category | Small Molecules |
Description | Gnetucleistol B |
Purity | 98.00% |
MW | 274.272 |
Biological Activity | Gnetucleistol B is a useful organic compound for research related to life sciences and the catalog number is orb1992512. |
Formula | C15H14O5 |
SMILES | COc1c(O)cc(\C=C\c2c(O)cccc2O)cc1O |
Storage | -20°C |
Note | For research use only |