You have no items in your shopping cart.
Cart summary
Fasoracetam monohydrate
Catalog Number: orb1739526
| Catalog Number | orb1739526 |
|---|---|
| Category | Small Molecules |
| Description | Fasoracetam monohydrate |
| CAS Number | 2055646-53-0 |
| Purity | 0.98 |
| MW | 275.31 |
| SMILES | O.O=C([C@H]1CCC(=O)N1)N1CCCCC1 |
| Formula | C11H21N3O5 |
| Biological Activity | Fasoracetam monohydrate is a small synthetic molecule and a metabotropic glutamate receptor activator, which has previously undergone extensive Phase I-III clinical trials in humans for vascular dementia. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
