You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1306814 |
---|---|
Category | Small Molecules |
Description | EcDsbB-IN-9 |
Purity | 99.35% |
MW | 255.1 |
Biological Activity | EcDsbB-IN-9 is a specific EcDsbB inhibitor, targeting disulfide bond forming enzyme DsbB of Gram-negative bacteria. |
CAS Number | 41933-33-9 |
Formula | C11H8Cl2N2O |
SMILES | Clc1cnn(Cc2ccccc2)c(=O)c1Cl |
Storage | -20°C |
Note | For research use only |