You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb15817 |
---|---|
Category | Small Molecules |
Description | Dinoprost(Prostaglandin F2α) is a naturally occurring prostaglandin used in medicine to induce labor and as an abortifacient. |
CAS Number | [551-11-1] |
MW | 354.481 |
SMILES | O([H])[C@@]1([H])C([H])([H])[C@]([H])([C@]([H])(/C(/[H])=C(\[H])/[C@]([H])(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])O[H])[C@@]1([H])C([H])([H])/C(/[H])=C(/[H])\C([H])([H])C([H])([H])C([H])([H])C(=O)O[H])O[H] |
Formula | C20H34O5 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
551-11-1 | |
354.48 | |
C20H34O5 |
99.73% | |
38562-01-5 | |
475.62 | |
C24H45NO8 |