You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1981096 |
---|---|
Category | Small Molecules |
Description | [D-Lys6]-LH-RH, a Luteinizing-hormone-releasing hormone (LHRH) analogue, serves as a GnRH receptor agonist [1]. |
Purity | 98.00% |
MW | 1253.41 |
Biological Activity | [D-Lys6]-LH-RH, a Luteinizing-hormone-releasing hormone (LHRH) analogue, serves as a GnRH receptor agonist [1]. |
CAS Number | 52671-12-2 |
Formula | C59H84N18O13 |
SMILES | CC(C)C[C@H](NC(=O)[C@@H](CCCCN)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H]1CCC(=O)N1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)NCC(N)=O |
Storage | -20°C |
Note | For research use only |