You have no items in your shopping cart.
Cart summary
Cleroindicin C
Catalog Number: orb1684107
| Catalog Number | orb1684107 |
|---|---|
| Category | Small Molecules |
| Description | Cleroindicin C |
| Purity | 98.00% |
| MW | 156.18 |
| Biological Activity | Cleroindicin C is a natural product from plants |
| CAS Number | 183626-28-0 |
| Formula | C8H12O3 |
| SMILES | O[C@@]1(CCC(C2)=O)[C@H]2OCC1 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
