You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1089676 |
---|---|
Category | Small Molecules |
Description | CK 666 (CK 0944666) is a small molecule Arp2/3 complex inhibitor with IC50 of 4 uM, inhibits actin polymerization with either BtArp2/3 complex (IC50=17 uM) or SpArp2/3 complex (IC50=5 uM). |
CAS Number | [442633-00-3] |
MW | 296.338787794113 |
SMILES | O=C(C1=CC=CC=C1F)NCCC1=C(C)NC2=CC=CC=C12 |
Formula | C18H17FN2O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |