You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1687282 |
---|---|
Category | Small Molecules |
Description | CB1 agonist 1 |
Purity | 98.56% |
MW | 452.52 |
Biological Activity | CB1 agonist 1 is a potent CB1 agonist with a pIC50 value of 5.7 for CB1 receptors.CB1 agonist 1 can be used to study brain disorders, pain, and inflammation. |
CAS Number | 851212-80-1 |
Formula | C24H24N2O5S |
SMILES | Cc1ccc(NC(=O)c2ccccc2Oc2ccccc2)cc1S(=O)(=O)N1CCOCC1 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
406205-74-1 | |
453.4 | |
C18H13F6NO4S |
> 98%(HPLC) | |
158681-13-1 | |
500.3 | |
C22H22Cl4N4O |
> 98%(HPLC) | |
168273-06-1 | |
463.8 | |
C22H21Cl3N4O |
99.12% | |
852315-00-5 | |
514.79 | |
C25H18Cl3N3O3 |