You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611688 |
---|---|
Category | Small Molecules |
Description | A synthetic benzylamine antifungal that inhibits the synthesis of ergosterol by inhibiting squalene epoxidase. |
CAS Number | [101827-46-7] |
MW | 353.934 |
SMILES | Cl.CN(CC1=CC=CC2=CC=CC=C12)CC1=CC=C(C(C)(C)C)C=C1 |
Formula | C23H28ClN |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.90% | |
101827-46-7 | |
353.93 | |
C23H28ClN |