You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1983721 |
---|---|
Category | Small Molecules |
Description | Biotinoyl tripeptide-1 can produce hair follicles by promoting scalp micro-circulation and reduce follicle atrophy and aging. |
Purity | 98.00% |
MW | 566.67 |
Biological Activity | Biotinoyl tripeptide-1 can produce hair follicles by promoting scalp micro-circulation and reduce follicle atrophy and aging. |
CAS Number | [299157-54-3] |
Formula | C24H38N8O6S |
SMILES | C(CCCC(NCC(N[C@@H](CC1=CN=CN1)C(N[C@@H](CCCCN)C(O)=O)=O)=O)=O)[C@H]2[C@@]3([C@](CS2)(NC(=O)N3)[H])[H] |
Storage | -20°C |
Note | For research use only |
98.86% | |
626.72 | |
C26H42N8O8S |