You have no items in your shopping cart.
Cart summary
Arctinol B
Catalog Number: orb1684112
| Catalog Number | orb1684112 |
|---|---|
| Category | Small Molecules |
| Description | Arctinol B |
| Purity | 98.00% |
| MW | 264.36 |
| Biological Activity | Arctinol B is a natural product from Arctium lappa L |
| Formula | C13H12O2S2 |
| SMILES | CC#Cc1ccc(s1)-c1ccc(s1)C(O)CO |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
