You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2567132 |
---|---|
Category | Small Molecules |
Description | AA-14 is an agonist for the orphan G protein-coupled receptor GPR101 that partially restores the function of the GH/IGF-1 axis [1]. |
Purity | 98.00% |
MW | 311.33 |
CAS Number | 723740-38-3 |
Formula | C14H12F3N3S |
SMILES | FC(F)(F)C=1C=CC=C(C1)NC(=S)NC2=NC=CC(=C2)C |
Storage | -20°C |
Note | For research use only |
WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |