You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2283455 |
---|---|
Category | Small Molecules |
Description | 6-O-Propynyl-2'-deoxyguanosine, a click chemistry reagent with an alkyne group, facilitates research in various biochemical [1] contexts. |
CAS Number | 1640051-47-3 |
Purity | 98.00% |
MW | 305.29 |
SMILES | O(CC#C)C1=C2C(N(C=N2)[C@@H]3O[C@H](CO)[C@@H](O)C3)=NC(N)=N1 |
Formula | C13H15N5O4 |
Biological Activity | 6-O-Propynyl-2'-deoxyguanosine, a click chemistry reagent with an alkyne group, facilitates research in various biochemical [1] contexts. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |