You have no items in your shopping cart.
Cart summary
5,7-Dihydroxy-2-isopropylchromone
Catalog Number: orb1992693
| Catalog Number | orb1992693 |
|---|---|
| Category | Small Molecules |
| Description | 5,7-Dihydroxy-2-isopropylchromone |
| Purity | 98.00% |
| MW | 220.224 |
| Biological Activity | 5,7-Dihydroxy-2-isopropylchromone is a useful organic compound for research related to life sciences and the catalog number is orb1992693. |
| Formula | C12H12O4 |
| SMILES | CC(C)c1cc(=O)c2c(O)cc(O)cc2o1 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
