You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2695759 |
---|---|
Category | Small Molecules |
Description | 5-Chloro-2-methoxybenzoic acid is a pharmaceutical intermediate. |
Purity | 99.61% |
MW | 186.59 |
CAS Number | 3438-16-2 |
Formula | C8H7ClO3 |
SMILES | COC1=C(C=C(Cl)C=C1)C(O)=O |
Storage | -20°C |
Note | For research use only |
99.78% | |
7206-70-4 | |
201.61 | |
C8H8ClNO3 |