You have no items in your shopping cart.
Cart summary
2,4-Dihydroxy-6-methoxy-3-formylacetophenone
Catalog Number: orb1991952
| Catalog Number | orb1991952 |
|---|---|
| Category | Small Molecules |
| Description | 2,4-Dihydroxy-6-methoxy-3-formylacetophenone |
| Purity | 98.00% |
| MW | 210.185 |
| SMILES | COc1cc(O)c(C=O)c(O)c1C(C)=O |
| Formula | C10H10O5 |
| Biological Activity | 2,4-Dihydroxy-6-methoxy-3-formylacetophenone is a useful organic compound for research related to life sciences and the catalog number is orb1991952. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
