You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1306771 |
---|---|
Category | Small Molecules |
Description | 2'-Deoxyadenosine |
CAS Number | 958-09-8 |
Purity | 98% |
MW | 251.24 |
SMILES | Nc1ncnc2n(cnc12)[C@H]1C[C@H](O)[C@@H](CO)O1 |
Formula | C10H13N5O3 |
Biological Activity | 2'-Deoxyadenosine (NSC-141848) is the DNA nucleoside A. It pairs with deoxythymidine (T) in double-stranded DNA. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.38% | |
72003-83-9 | |
455.17 | |
C10H13N5Na2O9P2 |
98% | |
54680-12-5 | |
557.13 | |
C10H16N5NaO12P3 |