You have no items in your shopping cart.
Cart summary
1,7-Dibenzyl-3-methylxanthine
Catalog Number: orb1907871
| Catalog Number | orb1907871 |
|---|---|
| Category | Small Molecules |
| Description | 1,7-Dibenzyl-3-methylxanthine belongs to Heterocyclic Compounds - Purines. |
| Purity | 98.00% |
| MW | 346.38 |
| Biological Activity | 1,7-Dibenzyl-3-methylxanthine belongs to Heterocyclic Compounds - Purines. |
| CAS Number | 16154-03-3 |
| Formula | C20H18N4O2 |
| SMILES | C(N1C2=C(N=C1)N(C)C(=O)N(CC3=CC=CC=C3)C2=O)C4=CC=CC=C4 |
| Storage | -20°C |
| Note | For research use only |
