You have no items in your shopping cart.
Cart summary
1,2-Didehydrocryptotanshinone
Catalog Number: orb1992576
| Catalog Number | orb1992576 |
|---|---|
| Category | Small Molecules |
| Description | 1,2-Didehydrocryptotanshinone |
| Purity | 98.00% |
| MW | 294.35 |
| Biological Activity | 1,2-Didehydrocryptotanshinone is a useful organic compound for research related to life sciences and the catalog number is orb1992576. |
| Formula | C19H18O3 |
| SMILES | C[C@H]1COC2=C1C(=O)C(=O)c1c2ccc2c1C=CCC2(C)C |c:4,19| |
| Storage | -20°C |
| Note | For research use only |
