You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304657 |
---|---|
Category | Small Molecules |
Description | Steviol |
Purity | 98.61% |
MW | 318.45 |
Biological Activity | 1. Steviol (NSC-226902), a natural sweetener, it inhibits proliferation of the gastrointestinal cancer cells intensively. 2. Steviol can induce a significant increase in CYP3A29 expression. 3. Steviol inhibits the proliferation of the human osteosarcoma U2OS cell line in a dose- and time-dependent manner. 4. Steviol can treat polycystic kidney disease, it slowed cyst growth, in part, by reducing AQP2 transcription, promoted proteasome, and lysosome-mediated AQP2 degradation. |
CAS Number | [471-80-7] |
Formula | C20H30O3 |
SMILES | C[C@]12CCC[C@](C)([C@@H]1CC[C@]13CC(=C)[C@@](O)(C1)CC[C@H]23)C(O)=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
471-80-7 | |
318.5 | |
C20H30O3 |
99.37% | |
[1185737-16-9] | |
480.59 | |
C26H40O8 |