You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb105090 |
---|---|
Category | Small Molecules |
Description | Ruscogenin |
CAS Number | [472-11-7] |
Purity | > 98%,Standard References |
MW | 430.62 |
SMILES | C[C@]1([C@]2([H])[C@@](CC=C3[C@]4(C)[C@H](O)C[C@H](O)C3)([H])[C@]4([H])CC1)[C@]5([H])[C@@](C2)([H])O[C@]6(CC[C@@H](C)CO6)[C@H]5C |
Formula | C27H42O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
1220707-31-2 | |
871.02 | |
C44H70O17 |
99.87% | |
472-11-7 | |
430.62 | |
C27H42O4 |
99.32% | |
874485-32-2 | |
430.62 | |
C27H42O4 |
98% | |
125225-63-0 | |
708.886 | |
C38H60O12 |