You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300227 |
---|---|
Category | Small Molecules |
Description | Ruscogenin |
CAS Number | 472-11-7 |
Purity | 99.87% |
MW | 430.62 |
SMILES | C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@@H](O)C[C@@H](O)[C@]5(C)[C@H]4CC[C@]23C)O[C@]11CC[C@@H](C)CO1 |
Formula | C27H42O4 |
Biological Activity | 1. Ruscogenin has anti-inflammatory activity, suppressed zymosan A-evoked peritoneal total leukocyte migration in mice in a dose-dependent manner, 2. Ruscogenin inhibited adhesion of leukocytes to a human umbilical vein endothelial cell line (ECV34) injured by tumor necrosis factor-alpha (TNF-alpha) in a concentration-dependent manner. 3. Ruscogenin significantly attenuate LPS-induced acute lung injury via inhibiting expressions of TF and iNOS and NF-kappa B p65 activation. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
1220707-31-2 | |
871.02 | |
C44H70O17 |
99.32% | |
874485-32-2 | |
430.62 | |
C27H42O4 |
98% | |
125225-63-0 | |
708.886 | |
C38H60O12 |