You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2646550 |
---|---|
Category | Small Molecules |
Description | 100 mM Sodium salt solution |
CAS Number | 102783-51-7 |
SMILES | P(=O)(OP(=O)(O)O)(O)OP(=O)(O)OC[C@H]1O[C@H](C[C@@H]1O)n1c(=O)[nH]c(=O)c(c1)/C=C/CNC(=O)CCCCCNC(=O)CCCCCNC(=O)CCCCC[N+]1=C(C(C)(c2cc(ccc12)S(=O)(=O)O)CCCCS(=O)(=O)[O-])/C=C/C=C/C=C\1/N(c2ccc(cc2C1(C)C)S(=O)(=O)O)CCCS(=O)(=O)O |
Storage | store at -20 °C |
Note | For research use only |
≥ 93% (HPLC) | |
115899-39-3 | |
Theoretical MW: 520.22 g/mol (free acid); Detected MW: 520.02 g/mol (free acid) | |
C12H19N4O13P3 |
≥ 93% (HPLC) | |
115899-39-3 | |
Theoretical MW: 520.22 g/mol (free acid); Detected MW: 520.02 g/mol (free acid) | |
C12H19N4O13P3 |
≥ 93% (HPLC) | |
115899-39-3 | |
Theoretical MW: 520.22 g/mol (free acid); Detected MW: 520.02 g/mol (free acid) | |
C12H19N4O13P3 |
≥ 99% (HPLC) | |
102783-51-7 | |
Theoretical MW: 467.15 g/mol (free acid) | |
C9H16N3O13P3 |
≥ 99% (HPLC) | |
102783-51-7 | |
Theoretical MW: 467.15 g/mol (free acid) | |
C9H16N3O13P3 |