You have no items in your shopping cart.
Cart summary
Alisol B
Catalog Number: orb1301507
| Catalog Number | orb1301507 |
|---|---|
| Category | Small Molecules |
| Description | Alisol B |
| CAS Number | 18649-93-9 |
| Purity | 98.00% |
| MW | 472.7 |
| SMILES | C[C@H](C[C@H](O)[C@H]1OC1(C)C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1 |
| Formula | C30H48O4 |
| Biological Activity | Alisol B may be a potential novel therapeutic molecule for bone disorders through targeting the differentiation of osteoclasts as well as their functions. Alisol B also inhibited RANKL-induced expression of NFATc1 and c-Fos, which are key transcription factors for osteoclastogenesis. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
Alisol B 23-acetate [orb1300161]
99.87%
26575-95-1
514.74
C32H50O5
1 ml x 10 mm (in DMSO), 5 mg, 10 mg, 25 mg, 50 mg, 100 mg
