You have no items in your shopping cart.
Cart summary
Wedelobatin A
Catalog Number: orb2299448
| Catalog Number | orb2299448 |
|---|---|
| Category | Small Molecules |
| Description | Wedelobatin A, a natural product, originates from Wedelia trilobata. |
| CAS Number | 1589488-34-5 |
| Purity | 98.00% |
| MW | 454.68 |
| SMILES | C[C@]12[C@]3([C@]4(C[C@@](CC3)(C(=C)C4)[H])CC[C@@]1([C@@](C(O[C@@H]5[C@@H]([C@H](C)C)C[C@H](O)C(C)=C5)=O)(C)CCC2)[H])[H] |
| Formula | C30H46O3 |
| Biological Activity | Wedelobatin A, a natural product, originates from Wedelia trilobata. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
