You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1310349 |
---|---|
Category | Small Molecules |
Description | Ursolic acid |
Purity | 99.79% |
MW | 456.7 |
Biological Activity | Ursolic acid (Prunol)(Bungeolic acid), a natural pentacyclic triterpenoid carboxylic acid, shows anti-tumor effects. |
CAS Number | [77-52-1] |
Formula | C30H48O3 |
SMILES | C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)C5CC[C@@]34C)[C@@H]2[C@H]1C)C(O)=O |
Storage | -20°C |
Note | For research use only |
98.30% | |
[7372-30-7] | |
498.74 | |
C32H50O4 |