You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300010 |
---|---|
Category | Small Molecules |
Description | Urolithin A |
Purity | 99.66% |
MW | 228.2 |
Biological Activity | Urolithin A is a secondary metabolite of ellagic acid, a polyphenolic antioxidant, that has antiproliferative, anti-inflammatory, and anti-oxidant properties. |
CAS Number | [1143-70-0] |
Formula | C13H8O4 |
SMILES | Oc1ccc2c(c1)oc(=O)c1cc(O)ccc21 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
1143-70-0 | |
228.2 | |
C13H8O4 |
> 98% (HPLC) | |
1006683-97-1 | |
260.2 | |
C13H8O6 |
> 98% (HPLC) | |
1139-83-9 | |
212.2 | |
C13H8O3 |
95.32% | |
91485-02-8 | |
276.2 | |
C13H8O7 |
99.87% | |
131086-98-1 | |
260.2 | |
C13H8O6 |