You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1691885 |
---|---|
Category | Small Molecules |
Description | TLR7 agonist 3 |
Purity | 99.27% |
MW | 312.41 |
Biological Activity | TLR7 agonist 3 (Compound 2), a potent activator of toll-like receptor 7 (TLR7), plays a critical role in initiating immune responses, positioning it as a promising target for immunomodulator development. |
CAS Number | 1229024-78-5 |
Formula | C18H24N4O |
SMILES | OC(C)(C)CN1C(=NC=2C(=NC=3C=CC=CC3C21)N)CCCC |
Storage | -20°C |
Note | For research use only |
98.00% | |
2389988-34-3 | |
353.33 | |
C14H19N5O6 |
99.93% | |
[642473-95-8] | |
313.4 | |
C17H23N5O |