You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2647608 |
---|---|
Category | Small Molecules |
Description | Thalidomide-NH-CH2-COOH is the Thalidomide-based cereblon ligand used in the recruitment of CRBN protein. Thalidomide-NH-CH2-COOH can be connected to the ligand for protein by a linker to form PROTACs, such as THAL-SNS-032. |
CAS Number | [927670-97-1] |
MW | 331.280223608017 |
SMILES | O=C(CNC1C2=C(C(N(C3CCC(=O)NC3=O)C2=O)=O)C=CC=1)O |
Formula | C15H13N3O6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
95.00% | |
2377032-39-6 | |
445.3036 | |
C17H14F3N3O8 |
96.38% | |
927670-97-1 | |
331.28 | |
C15H13N3O6 |