You have no items in your shopping cart.
Cart summary
Tenuifoliside B
Catalog Number: orb1301569
| Catalog Number | orb1301569 |
|---|---|
| Category | Small Molecules |
| Description | Tenuifoliside B |
| Purity | 99.69% |
| MW | 668.6 |
| Biological Activity | Tenuifoliside B is a natural product from the roots of Polygala tenuifolia.And is a target lactate dehydrogenase inhibitor. Tenuifoliside B has cognitive improving and cerebral protective effects. it can inhibit potassium cyanide (KCN)-induced hypoxia and scopolamine-induced memory impairment in mice. |
| CAS Number | [139726-36-6] |
| Formula | C30H36O17 |
| SMILES | COc1cc(\C=C\C(=O)O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](COC(=O)c3ccc(O)cc3)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O |
| Storage | -20°C |
| Note | For research use only |
Tenuifoliside B [orb1220773]
> 98% (HPLC)
139726-36-6
668.6
C30H36O17
5 mg, 10 mg, 25 mg, 50 mg, 100 mg, 1 g, 500 mg, 200 mg
