You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1684185 |
---|---|
Category | Small Molecules |
Description | Taccalonolide B |
Purity | 99.69% |
MW | 660.71 |
Biological Activity | Taccalonolide B is effective in vitro against cell lines that overexpress P-glycoprotein (Pgp) and multidrug-resistance protein (MRP7). Taccalonolide B inhibits growth of SK-OV-3 cells with an IC50 of 208 nM. |
CAS Number | [108885-69-4] |
Formula | C34H44O13 |
SMILES | C[C@@]12[C@@]3([C@]([C@]4([C@](C)([C@@H](OC(C)=O)[C@H]3OC(C)=O)[C@@]5([C@@]([C@@H]4O)([C@]6(C)C(=C[C@H]5C)OC(=O)[C@@]6(C)O)[H])[H])[H])([C@@H](O)C(=O)[C@]1(C[C@]7([C@@]([C@@H]2OC(C)=O)(O7)[H])[H])[H])[H])[H] |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
108885-69-4 | |
660.7 | |
C34H44O13 |