You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611437 |
---|---|
Category | Small Molecules |
Description | SMAP (DT-061, DT061) is an orally bioavailable small molecule activator of PP2A, inhibits KRAS-driven tumor growth. |
MW | 520.52073597908 |
CAS Number | [1809427-18-6] |
Formula | C25H23F3N2O5S |
SMILES | S(C1C=CC(=CC=1)OC(F)(F)F)(N[C@@H]1CCC[C@@H]([C@H]1O)N1C2C=CC=CC=2OC2C=CC=CC1=2)(=O)=O |
Note | For research use only |
ICC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Equine, Gallus, Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ICC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Equine, Gallus, Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ICC, IHC-P, WB | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |