You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1297647 |
---|---|
Category | Small Molecules |
Description | Segetalin B |
Purity | 99.64% |
MW | 484.55 |
Biological Activity | Segetalin B is a natural product from Vaccaria segetalis (Neck.) Garcke, has estrogen-like activity. |
CAS Number | [164991-89-3] |
Formula | C24H32N6O5 |
SMILES | CC(C)[C@@H]1NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](C)NC1=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
164991-89-3 | |
484.6 | |
C24H32N6O5 |