You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2299461 |
---|---|
Category | Small Molecules |
Description | (+)-Secoisolariciresinol, a lignan, represents the (+)-enantiomer of Secoisolariciresinol [1]. |
CAS Number | 145265-02-7 |
Purity | 98.00% |
MW | 362.42 |
SMILES | C([C@@H]([C@H](CC1=CC(OC)=C(O)C=C1)CO)CO)C2=CC(OC)=C(O)C=C2 |
Formula | C20H26O6 |
Biological Activity | (+)-Secoisolariciresinol, a lignan, represents the (+)-enantiomer of Secoisolariciresinol [1]. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
257930-74-8 | |
686.7 | |
C32H46O16 |
98% | |
63320-67-2 | |
524.56 | |
C26H36O11 |
100.00% | |
148244-82-0 | |
686.704 | |
C32H46O16 |