You have no items in your shopping cart.
Cart summary
S1PR1 agonist 1
Catalog Number: orb1686665
| Catalog Number | orb1686665 |
|---|---|
| Category | Small Molecules |
| Description | S1PR1 agonist 1 |
| Purity | 98.00% |
| MW | 498.57 |
| Biological Activity | S1PR1 agonist 1 is a potent agonist of S1PR1. S1PR1 agonist 1 has potential in autoimmune diseases. |
| CAS Number | 2700209-37-4 |
| Formula | C29H30N4O4 |
| SMILES | C(N1CC2(C=3C(CC2)=C(C=CC3)C=4N=C(ON4)C5=CC(C#N)=C(OC(C)C)C=C5)CC1)C6(C(O)=O)CC6 |
| Storage | -20°C |
| Note | For research use only |
